80018-29-7 Usage
Description
(6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one is a complex organic chemical compound characterized by a cyclohexa-2,4-dien-1-one backbone with a 2-chlorophenyl and a 4-methylpentan-2-ylamino substituent. (6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one is considered potentially hazardous and should be handled with caution. Its specific properties and potential applications, which may include pharmaceutical or industrial uses, would require further research and testing to be fully understood.
Uses
Used in Pharmaceutical Industry:
(6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one is used as a potential active pharmaceutical ingredient for the development of new drugs. Its unique chemical structure may offer novel interactions with biological targets, potentially leading to the creation of innovative therapeutics.
Used in Chemical Research:
In the field of chemical research, (6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one can be utilized as a starting material or a synthetic intermediate for the development of other complex organic molecules. Its reactivity and structural features may facilitate the synthesis of new compounds with various applications.
Used in Material Science:
(6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one may also find applications in material science, particularly in the development of novel polymers or other advanced materials. Its specific chemical properties could contribute to the creation of materials with unique characteristics, such as improved strength, durability, or chemical resistance.
Please note that the above uses are speculative and based on the general knowledge of similar compounds. The actual applications of (6Z)-4-chloro-6-[(2-chlorophenyl)-(4-methylpentan-2-ylamino)methyliden e]cyclohexa-2,4-dien-1-one would need to be confirmed through further investigation and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 80018-29-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,1 and 8 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 80018-29:
(7*8)+(6*0)+(5*0)+(4*1)+(3*8)+(2*2)+(1*9)=97
97 % 10 = 7
So 80018-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H21Cl2NO/c1-12(2)10-13(3)22-19(15-6-4-5-7-17(15)21)16-11-14(20)8-9-18(16)23/h4-9,11-13,22H,10H2,1-3H3/b19-16-
