80079-49-8 Usage
Description
1-(2-methyl-1-oxoallyl)-5-oxo-L-proline is a chemical compound that belongs to the class of organic compounds known as pyrrolidine carboxylic acids. It is derived from proline, an amino acid, and is involved in the biosynthesis of the essential amino acid, L-proline. 1-(2-methyl-1-oxoallyl)-5-oxo-L-proline has a molecular formula of C8H11NO4 and a molecular weight of 189.17 g/mol. It has been studied for its potential biological activities, including anti-inflammatory and anti-cancer properties.
Uses
1. Used in Pharmaceutical Synthesis:
1-(2-methyl-1-oxoallyl)-5-oxo-L-proline is used as a building block for the synthesis of various pharmaceuticals and natural products. Its unique structure and functional groups make it a valuable component in the development of new drugs and therapeutic agents.
2. Used in Anti-inflammatory Applications:
1-(2-methyl-1-oxoallyl)-5-oxo-L-proline is used as an anti-inflammatory agent due to its potential biological activities. It may help in reducing inflammation and alleviating symptoms associated with various inflammatory conditions.
3. Used in Anticancer Applications:
1-(2-methyl-1-oxoallyl)-5-oxo-L-proline is used as an anticancer agent, as it has been studied for its potential anti-cancer properties. It may play a role in inhibiting the growth and progression of cancer cells, making it a promising candidate for further research and development in cancer treatment.
4. Used in Research and Development:
1-(2-methyl-1-oxoallyl)-5-oxo-L-proline is used in the research and development of new drugs and therapies, particularly in the fields of inflammation and cancer. Its unique structure and potential biological activities make it an interesting compound for scientists to study and explore its full potential in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 80079-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,7 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 80079-49:
(7*8)+(6*0)+(5*0)+(4*7)+(3*9)+(2*4)+(1*9)=128
128 % 10 = 8
So 80079-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO4/c1-5(2)8(12)10-6(9(13)14)3-4-7(10)11/h6H,1,3-4H2,2H3,(H,13,14)/t6-/m0/s1
80079-49-8Relevant articles and documents
A Convenient Preparation of N-Acylpyroglutamic Acid
Imaki, Katsuhiro,Niwa, Haruki,Sakuyama, Shigeru,Okada, Takanori,Toda, Masaaki,Hayashi, Masaki
, p. 2699 - 2701 (2007/10/02)
Pyroglutamic acid reacted with acyl chloride in the presence of triethylamine in acetonitrile, yielding N-acylpyroglutamic acid without epimerization by way of mixed anhydride formation followed by intramolecular N-acylation.Keywords - angiotensin-converting enzyme; pyroglutamic acid; N-acylpyroglutamic acid; (2S)-1-pyroglutamic acid; N-acetyl-L-pyroglutamic acid
