80088-37-5 Usage
Description
N-[5-(2-propynylthio)-1,3,4-thiadiazol-2-yl]acetamide is a thiadiazole derivative, a class of chemical compounds known for their potential biological activities. This yellow-colored solid has a molecular formula of C7H8N4OS2 and a molecular weight of 228.294 g/mol. Its structure features a thiadiazole ring and an acetamide group, along with a propynylthio group, making it a versatile compound for chemical reactions and modifications in pharmaceutical research and medicinal chemistry.
Uses
Used in Pharmaceutical Research:
N-[5-(2-propynylthio)-1,3,4-thiadiazol-2-yl]acetamide is used as a research compound for exploring its potential biological activities. Its unique structure allows for various chemical modifications, making it a valuable tool in the development of new pharmaceutical agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, N-[5-(2-propynylthio)-1,3,4-thiadiazol-2-yl]acetamide is used as a building block for the synthesis of novel compounds with potential therapeutic applications. Its ability to participate in various chemical reactions facilitates the creation of new molecules with desired properties.
Used in Organic Synthesis:
N-[5-(2-propynylthio)-1,3,4-thiadiazol-2-yl]acetamide is also utilized in organic synthesis due to the presence of the propynylthio group, which can be further modified or used to form new chemical entities with specific functions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80088-37-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,8 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 80088-37:
(7*8)+(6*0)+(5*0)+(4*8)+(3*8)+(2*3)+(1*7)=125
125 % 10 = 5
So 80088-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3OS2/c1-3-4-12-7-10-9-6(13-7)8-5(2)11/h1H,4H2,2H3,(H,8,9,11)
