80589-23-7 Usage
Description
2-furyl-4-ethoxymethylene-5-oxazolone is a 1,3-oxazole compound characterized by the presence of a 2-furyl substituent at the 2-position, an ethoxymethylene group at the 4-position, and an oxo group at the 5-position.
Uses
Used in Pharmaceutical Industry:
2-furyl-4-ethoxymethylene-5-oxazolone is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
2-furyl-4-ethoxymethylene-5-oxazolone is also used as a research compound in the field of organic chemistry. Its synthesis and properties are of interest to scientists studying the chemistry of heterocyclic compounds and their potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 80589-23-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,5,8 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80589-23:
(7*8)+(6*0)+(5*5)+(4*8)+(3*9)+(2*2)+(1*3)=147
147 % 10 = 7
So 80589-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO4/c1-2-13-6-7-10(12)15-9(11-7)8-4-3-5-14-8/h3-6H,2H2,1H3/b7-6+
