80765-80-6 Usage
General Description
Benzyl-3,5-di-O-benzyl-2-deoxy-2-fluoro-alpha-D-arabinofuranoside is a chemical compound with the formula C28H27FO5. It is a synthetic derivative of arabinofuranoside, a type of sugar molecule. BENZYL-3,5-DI-O-BENZYL-2-DEOXY-2-FLUORO-ALPHA-D-ARABINOFURANOSIDE has two benzyl groups attached to the 3 and 5 positions of the arabinofuranoside ring, as well as a fluorine atom and a deoxy group at the 2 position. It is commonly used in the field of organic chemistry and biochemistry as a building block for the synthesis of other compounds. Its unique structure makes it a valuable tool for studying the properties and reactivity of sugar molecules in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 80765-80-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,6 and 5 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80765-80:
(7*8)+(6*0)+(5*7)+(4*6)+(3*5)+(2*8)+(1*0)=146
146 % 10 = 6
So 80765-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C26H27FO4/c27-24-25(29-17-21-12-6-2-7-13-21)23(19-28-16-20-10-4-1-5-11-20)31-26(24)30-18-22-14-8-3-9-15-22/h1-15,23-26H,16-19H2/t23-,24+,25-,26+/m1/s1