81-85-6 Usage
Description
6-Bromo-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione, also known as 6-Bromo-3-methyl anthrapyridone, is an organic compound that serves as a crucial intermediate in the synthesis of various dyes. It is characterized by its unique molecular structure, which includes a dibenz[f,ij]isoquinoline core with a bromine atom at the 6-position and a methyl group at the 3-position. 6-bromo-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione is soluble in organic solvents, making it suitable for use in the production of dyes that require solubility in such media.
Uses
Used in Dye Manufacturing Industry:
6-Bromo-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione is used as an intermediate in the synthesis of dyes that are soluble in organic solvents. Its unique molecular structure allows for the creation of dyes with specific properties, such as color, solubility, and stability, which are essential for various applications in the dye manufacturing industry.
Check Digit Verification of cas no
The CAS Registry Mumber 81-85-6 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 81-85:
(4*8)+(3*1)+(2*8)+(1*5)=56
56 % 10 = 6
So 81-85-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H10BrNO2/c1-19-13-7-6-12(18)16-15(13)11(8-14(19)20)9-4-2-3-5-10(9)17(16)21/h2-8H,1H3
81-85-6Relevant articles and documents
Synthesis of 4 - bromo - N - methyl - 1 (N)- 9 - anthracene and pyridone method (by machine translation)
-
Paragraph 0045; 0046, (2017/07/11)
The invention discloses a method for synthesizing 4 - bromo - N - methyl - 1 (N)- 9 - anthracene and pyridone method, ethanol and a small amount of tertiary butyl alcohol potassium input in the reactor, stirring to dissolve, the acylation material 1 - (N - methyl) b amido - 4 - bromo anthraquinone uniform stirring into the reactor, and then put into a small amount of calcium oxide, the beginning of the slow heating to a certain temperature, thermal insulation for a few hours, HPLC tracking, to be acylation material reaction finishes, can stop the insulation, to the room temperature, filtering and recycling the mother liquor, hot water washing, drying; the ring-closing reaction of the resulting product in the input to the sulfuric acid solution, beating a certain period of time at room temperature, filter, recovery of sulfuric acid solution, then with the same concentration of a sulfuric acid solution and the immersed material, filtering, the eluent with the mother liquid mixed collection, soft water washing materials to the washing water is neutral, discharging, drying. The invention mild reaction conditions, temperature and normal pressure reaction, the resulting product can reach 95%. (by machine translation)
