81155-58-0 Usage
Description
[[[[3-(aminomethyl)phenyl]methyl]amino]methyl]phenol is a complex organic compound with a molecular formula of C15H18N2O. It features a central phenol group surrounded by multiple amino and methyl groups, which may contribute to its unique pharmacological properties. [[[[3-(aminomethyl)phenyl]methyl]amino]methyl]phenol is of interest in medicinal chemistry due to its potential for pharmaceutical applications.
Uses
Used in Pharmaceutical Applications:
[[[[3-(aminomethyl)phenyl]methyl]amino]methyl]phenol is used as a potential pharmaceutical agent for various applications due to its amine and phenolic functional groups. These functional groups may allow the compound to interact with biological targets in ways that could be beneficial for treating certain conditions or diseases.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, [[[[3-(aminomethyl)phenyl]methyl]amino]methyl]phenol is used as a subject of study to explore its potential pharmacological properties and applications. Further research is needed to fully understand its characteristics and how it can be utilized in the development of new drugs or therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 81155-58-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,1,5 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 81155-58:
(7*8)+(6*1)+(5*1)+(4*5)+(3*5)+(2*5)+(1*8)=120
120 % 10 = 0
So 81155-58-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O/c16-9-12-4-3-5-13(8-12)10-17-11-14-6-1-2-7-15(14)18/h1-8,17-18H,9-11,16H2
