819850-15-2 Usage
Description
2-Methyl-3-pyrimidin-4-yl-propionic acid, also known as MPPA, is a chemical compound with the molecular formula C8H9N2O2. It is a derivative of pyrimidine and propionic acid, characterized by its potential applications in the synthesis of pharmaceuticals and agrochemicals. MPPA is being researched for its potential therapeutic properties, particularly in the development of anti-inflammatory drugs, and serves as a precursor in organic synthesis for the production of various compounds. It may also contribute to the development of novel materials and the production of various industrial products.
Uses
Used in Pharmaceutical Industry:
MPPA is used as a key intermediate in the synthesis of various pharmaceuticals for its potential therapeutic properties. It plays a crucial role in the development of anti-inflammatory drugs, offering a promising avenue for treating inflammation-related conditions.
Used in Agrochemical Industry:
In the agrochemical sector, MPPA is utilized as a precursor in the synthesis of agrochemicals, contributing to the development of products that enhance crop protection and yield.
Used in Organic Synthesis:
MPPA serves as a valuable precursor in organic synthesis, enabling the production of a wide range of compounds for various applications across different industries.
Used in Material Science:
With its potential use in the development of novel materials, MPPA contributes to material science, facilitating the creation of innovative materials with unique properties for diverse applications.
Used in Industrial Product Production:
MPPA may also be utilized in the production of various industrial products, highlighting its versatility and applicability across a broad spectrum of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 819850-15-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,9,8,5 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 819850-15:
(8*8)+(7*1)+(6*9)+(5*8)+(4*5)+(3*0)+(2*1)+(1*5)=192
192 % 10 = 2
So 819850-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-6(8(11)12)5-7-9-3-2-4-10-7/h2-4,6H,5H2,1H3,(H,11,12)
