82820-30-2 Usage
Description
2-(Benzoylmethyl)-pyrimidine is a heterocyclic chemical compound with a molecular formula C13H10N2O. It features a pyrimidine ring fused with a benzene ring, to which a benzoylmethyl group is attached. 2-(BENZOYLMETHYL)-PYRIMIDINE holds promise for various applications due to its unique structure and potential biological activities.
Uses
Used in Pharmaceutical Industry:
2-(Benzoylmethyl)-pyrimidine serves as an intermediate in the synthesis of pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(Benzoylmethyl)-pyrimidine acts as a building block in the creation of new agrochemicals. Its potential to be modified and combined with other molecules makes it valuable for developing innovative products to address agricultural challenges.
Used in Research Applications:
2-(Benzoylmethyl)-pyrimidine has been studied for its potential biological activities, such as anti-inflammatory and anticancer properties. Researchers utilize this compound to explore its effects on various biological systems and to understand its mechanisms of action, which can lead to the discovery of new therapeutic agents.
Overall, 2-(Benzoylmethyl)-pyrimidine is a versatile and valuable chemical compound with significant potential in pharmaceutical, agrochemical, and research applications. Its unique structure and potential biological activities make it an important molecule for further exploration and development.
Check Digit Verification of cas no
The CAS Registry Mumber 82820-30-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,2 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82820-30:
(7*8)+(6*2)+(5*8)+(4*2)+(3*0)+(2*3)+(1*0)=122
122 % 10 = 2
So 82820-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O/c15-11(10-5-2-1-3-6-10)9-12-13-7-4-8-14-12/h1-8H,9H2
82820-30-2Relevant articles and documents
Reaction of Substituted 2- and 4-Methylpyrimidines with Aromatic Carboxylic Acid Chlorides
Khutova, B. M.,Klyuchko, S. V.,Prikazchikova, L. P.,Cherkasov, V. M.
, p. 522 - 525 (2007/10/02)
The effect of substituents in methylpyrimidines on the reaction of the methyl groups with aromatic carboxylic acid chlorides in the presence of triethylamine was studied.It is shown that, depending on the character of the substituents, the reaction with the acid chlorides takes place at the methyl groups or at the ring nitrogen atoms.
