82921-86-6 Usage
Description
3,8-Dinitro-6-phenylphenanthridine, with the chemical formula C20H11N3O4 and CAS number 82921-86-6, is a yellow solid compound that plays a significant role in organic synthesis. Its unique structure and properties make it a valuable component in various chemical reactions and processes.
Uses
Used in Organic Synthesis:
3,8-Dinitro-6-phenylphenanthridine is used as a key intermediate in the synthesis of various organic compounds. Its presence in reactions can lead to the formation of new molecules with different functional groups and properties, expanding the scope of organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,8-dinitro-6-phenylphenanthridine is used as a building block for the development of new drugs and medicinal compounds. Its unique structure allows for the creation of molecules with potential therapeutic effects, contributing to the advancement of medicine and healthcare.
Used in Chemical Research:
3,8-Dinitro-6-phenylphenanthridine is also utilized in chemical research to study the properties and behavior of various organic compounds. Its reactivity and stability make it an ideal candidate for investigating reaction mechanisms, understanding molecular interactions, and developing new synthetic methods.
Used in Dye and Pigment Industry:
The yellow color of 3,8-dinitro-6-phenylphenanthridine makes it a potential candidate for use in the dye and pigment industry. It can be employed to create new dyes and pigments with specific color properties, enhancing the range of colors available for various applications, such as textiles, plastics, and paints.
Check Digit Verification of cas no
The CAS Registry Mumber 82921-86-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,9,2 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82921-86:
(7*8)+(6*2)+(5*9)+(4*2)+(3*1)+(2*8)+(1*6)=146
146 % 10 = 6
So 82921-86-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H11N3O4/c23-21(24)13-6-8-15-16-9-7-14(22(25)26)11-18(16)20-19(17(15)10-13)12-4-2-1-3-5-12/h1-11H
82921-86-6Relevant articles and documents
Improvement of ways to obtain ethidium bromide and synthesis of ethidium ethyl sulfate, a new fluorescent dye for detection of nucleic acids
Osadchii,Shubin,Kozlova,Varlamenko,Filipenko,Boyarskikh
scheme or table, p. 1541 - 1548 (2012/01/14)
Two methods for synthesis of ethidium bromide, a fluorescent dye widely used in molecular biology, were improved. An analog of ethidium bromide, ethidium ethyl sulfate, was synthesized.