836-06-6 Usage
Description
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine is a pyrimidine derivative with the molecular formula C11H10FN5. It features a fluorobenzyl group and two amino groups, making it a versatile chemical compound with potential applications in various fields.
Used in Pharmaceutical Industry:
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine is used as a building block for the synthesis of various pharmaceuticals, particularly those targeting the central nervous system. Its unique structure allows for the development of drugs with specific therapeutic effects.
Used in Antiviral Applications:
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine is studied for its potential antiviral properties, which could lead to the development of new treatments for viral infections.
Used in Anticancer Applications:
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine has also been investigated for its potential anticancer properties, indicating its possible use in the development of cancer therapies.
Used in Materials Science:
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine has potential applications in the field of materials science, particularly in the development of novel organic electronic materials, due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 836-06-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,3 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 836-06:
(5*8)+(4*3)+(3*6)+(2*0)+(1*6)=76
76 % 10 = 6
So 836-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H11FN4/c12-9-3-1-7(2-4-9)5-8-6-15-11(14)16-10(8)13/h1-4,6H,5H2,(H4,13,14,15,16)
