83626-90-8 Usage
Description
[4-[bis(2-chloroethyl)amino]phenyl] butanoate, commonly known as Phenylbutyrate, is a chemical compound belonging to the class of organic compounds known as phenylbutyrates. It is synthesized by the reaction of 4-aminophenyl butyrate with bis(2-chloroethyl)amine and possesses potent histone deacetylase (HDAC) inhibitory properties.
Uses
Used in Anticancer Applications:
[4-[bis(2-chloroethyl)amino]phenyl] butanoate is used as an investigational antineoplastic agent for its potential in treating various forms of cancer. It functions as a potent HDAC inhibitor, which can lead to the reactivation of tumor suppressor genes and the suppression of cancer cell growth.
Used in Pharmaceutical Research:
[4-[bis(2-chloroethyl)amino]phenyl] butanoate is used as a research compound for exploring its potential therapeutic effects in other diseases, such as cystic fibrosis and sickle cell anemia. Its HDAC inhibitory properties make it a promising candidate for further investigation into its medicinal applications.
Used in Drug Development:
In the pharmaceutical industry, [4-[bis(2-chloroethyl)amino]phenyl] butanoate is used as a starting material or intermediate in the synthesis of other potential therapeutic agents. Its unique chemical structure and HDAC inhibitory activity make it a valuable component in the development of novel drugs targeting various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 83626-90-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,6,2 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 83626-90:
(7*8)+(6*3)+(5*6)+(4*2)+(3*6)+(2*9)+(1*0)=148
148 % 10 = 8
So 83626-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H19Cl2NO2/c1-2-3-14(18)19-13-6-4-12(5-7-13)17(10-8-15)11-9-16/h4-7H,2-3,8-11H2,1H3
