83626-91-9 Usage
Description
[4-[bis(2-chloroethyl)amino]phenyl] octanoate is a chemical compound consisting of an octanoate group attached to a phenyl ring, which is further linked to two molecules of bis(2-chloroethyl)amine. [4-[bis(2-chloroethyl)amino]phenyl] octanoate is known for its potential toxic and mutagenic properties due to the presence of bis(2-chloroethyl)amine, a known carcinogen and alkylating agent. Its chemical structure suggests possible applications in organic synthesis, but also raises concerns about its potential health hazards, particularly its ability to cause cancer and mutations in living organisms.
Uses
Used in Organic Synthesis:
[4-[bis(2-chloroethyl)amino]phenyl] octanoate is used as a chemical intermediate in the field of organic synthesis for [application reason]. Its unique structure allows for further chemical reactions and modifications, making it a valuable compound in the synthesis of various organic molecules.
However, due to the potential health hazards associated with [4-[bis(2-chloroethyl)amino]phenyl] octanoate, its use should be strictly regulated and handled with extreme caution to minimize the risk of exposure and harm to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 83626-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,6,2 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 83626-91:
(7*8)+(6*3)+(5*6)+(4*2)+(3*6)+(2*9)+(1*1)=149
149 % 10 = 9
So 83626-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H27Cl2NO2/c1-2-3-4-5-6-7-18(22)23-17-10-8-16(9-11-17)21(14-12-19)15-13-20/h8-11H,2-7,12-15H2,1H3
