83757-08-8 Usage
General Description
3-Benzylsulfanyl-[1,2,4]thiadiazol-5-ylamine is an organic compound with the chemical formula C9H8N4S. It is a yellow to light brown powder that is commonly used in medicinal chemistry and drug discovery research. This chemical is known for its potential use in the development of novel pharmaceuticals due to its diverse biological activities, including antimicrobial and antiproliferative properties. Additionally, it has shown promise as a potential anti-tumor and anti-inflammatory agent. Overall, 3-Benzylsulfanyl-[1,2,4]thiadiazol-5-ylamine has garnered significant interest in the scientific community for its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 83757-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,5 and 7 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83757-08:
(7*8)+(6*3)+(5*7)+(4*5)+(3*7)+(2*0)+(1*8)=158
158 % 10 = 8
So 83757-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3S2/c10-8-11-9(12-14-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11,12)