83798-91-8 Usage
Description
Z-GLY-GLY-TRP-OH is a C-terminal tryptophan-containing peptide that serves as a key intermediate in the synthesis of various compounds, particularly derivatives of 3,4-dihydro-β-carboline-3-carboxylic acid. This peptide is characterized by its unique structure and functional groups, which contribute to its potential applications in different fields.
Uses
Used in Pharmaceutical Industry:
Z-GLY-GLY-TRP-OH is used as a synthetic intermediate for the development of 3,4-dihydro-β-carboline-3-carboxylic acid derivatives. These derivatives possess a range of biological activities, including potential applications in the treatment of various diseases and disorders. The synthesis of these derivatives often relies on the unique properties of Z-GLY-GLY-TRP-OH, making it a valuable component in the pharmaceutical industry.
Used in Chemical Research:
In the field of chemical research, Z-GLY-GLY-TRP-OH serves as a versatile compound for studying the synthesis and properties of 3,4-dihydro-β-carboline-3-carboxylic acid derivatives. Researchers can use this peptide to explore new methods for the preparation of these compounds, as well as to investigate their chemical and biological properties. This can lead to the discovery of new applications and therapeutic potentials for these derivatives.
Used in Peptide Synthesis:
Z-GLY-GLY-TRP-OH can also be utilized in the synthesis of other peptides and peptide-based compounds. Its unique structure and functional groups make it a suitable candidate for the development of novel peptide sequences with specific biological activities. This can be particularly useful in the design of peptide drugs, where the incorporation of specific amino acid sequences can lead to the development of more effective and targeted therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 83798-91-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,9 and 8 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 83798-91:
(7*8)+(6*3)+(5*7)+(4*9)+(3*8)+(2*9)+(1*1)=188
188 % 10 = 8
So 83798-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H24N4O6/c28-20(12-26-23(32)33-14-15-6-2-1-3-7-15)25-13-21(29)27-19(22(30)31)10-16-11-24-18-9-5-4-8-17(16)18/h1-9,11,19,24H,10,12-14H2,(H,25,28)(H,26,32)(H,27,29)(H,30,31)