839720-60-4 Usage
General Description
5-Methyl-2-phenyl-1,3,2 dioxaborinane-5-carboxylic acid is a chemical compound with a specific organic structure. It's classified as a boronic ester, which are commonly used in organic synthesis and medicinal chemistry due to their ability to form stable boron-carbon bonds. The compound includes elements of methyl, phenyl, dioxaborinane, and carboxylic acid. Methyl groups contribute to the stability of the compound, the phenyl group is a functional group commonly used in organic chemistry, dioxaborinane is a boron-containing ring system, and carboxylic acid is an organic compound containing a carboxyl functional group. Specific uses or characteristics of this particular compound, however, are not widely documented and may depend on the context of its synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 839720-60-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,9,7,2 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 839720-60:
(8*8)+(7*3)+(6*9)+(5*7)+(4*2)+(3*0)+(2*6)+(1*0)=194
194 % 10 = 4
So 839720-60-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BO4/c1-11(10(13)14)7-15-12(16-8-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14)
839720-60-4Relevant articles and documents
COMPOUND FOR ORGANIC SYNTHETIC REACTION
-
Paragraph 0026; 0027, (2019/05/01)
PROBLEM TO BE SOLVED: To provide a compound for organic synthetic reaction capable of reducing unnecessary reaction byproduct and generating a targeted chemical reaction effectively, even when a base compound sensitive to basicity is used. SOLUTION: There is provided a compound for organic synthetic reaction which is used for a coupling reaction or an addition reaction forming a bond between carbon-carbon, and is a compound represented by the structure formula (1) or a salt thereof. In the formula, (A) represents an oxygen atom or a nitrogen atom, R1 represents a substituent containing one or more carbon atom, R2 represents a substituent containing one or more carbon atom, hydrogen or halogen, and R1 and R2 may be the same or different each other. SELECTED DRAWING: Figure 2 COPYRIGHT: (C)2019,JPOandINPIT
