84000-81-7 Usage
Chemical structure
A complex chemical compound containing a triazolium group and an azo dye.
Fields of application
Organic chemistry and material science.
Potential applications
Photoelectric devices, catalysis, and biological imaging.
Molecular structure
Unique molecular structure that makes it an interesting subject for further research and development.
Importance
Important compound for the study of advanced materials and their applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 84000-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,0 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84000-81:
(7*8)+(6*4)+(5*0)+(4*0)+(3*0)+(2*8)+(1*1)=97
97 % 10 = 7
So 84000-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N6.C2H4O2/c1-22(13-15-7-5-4-6-8-15)17-11-9-16(10-12-17)19-20-18-21-24(3)14-23(18)2;1-2(3)4/h4-12H,13-14H2,1-3H3;1H3,(H,3,4)