84041-65-6 Usage
Description
1-(2-nitrophenyl)ethyl acrylate is a chemical compound that belongs to the class of acrylates. It is a yellow liquid with a molecular formula C11H11NO4 and a molecular weight of 217.21 g/mol. 1-(2-nitrophenyl)ethyl acrylate is characterized by the presence of a nitro group and a phenyl group in its structure, which gives it some unique chemical properties.
Uses
Used in Polymer and Resin Production:
1-(2-nitrophenyl)ethyl acrylate is used as a monomer for the synthesis of various plastic materials. Its unique chemical properties, including the presence of a nitro group and a phenyl group, contribute to the formation of polymers and resins with specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 84041-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,4 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 84041-65:
(7*8)+(6*4)+(5*0)+(4*4)+(3*1)+(2*6)+(1*5)=116
116 % 10 = 6
So 84041-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO4/c1-3-11(13)16-8(2)9-6-4-5-7-10(9)12(14)15/h3-8H,1H2,2H3