84051-88-7 Usage
General Description
2-((4-(Ethyl(2-hydroxyethyl)amino)phenyl)azo)-6-methoxy-3-methylbenzothiazolium thiocyanate is a complex organic compound with a long chemical name. It is a derivative of benzothiazole and contains an azo group, a thiocyanate group, and an amino group. 2-((4-(Ethyl(2-hydroxyethyl)amino)phenyl)azo)-6-methoxy-3-methylbenzothiazolium thiocyanate is commonly used as a dye in the textile industry and as a fluorescent probe in biological research. It has potential applications in medical imaging, drug delivery, and materials science due to its unique chemical structure and properties. Additionally, it may also have potential use in the field of photovoltaics and electronics due to its light-emitting properties. The specific chemical structure and properties of this compound make it a versatile and potentially valuable tool in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 84051-88-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,5 and 1 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 84051-88:
(7*8)+(6*4)+(5*0)+(4*5)+(3*1)+(2*8)+(1*8)=127
127 % 10 = 7
So 84051-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H23N4O2S.CHNS/c1-4-23(11-12-24)15-7-5-14(6-8-15)20-21-19-22(2)17-10-9-16(25-3)13-18(17)26-19;2-1-3/h5-10,13,24H,4,11-12H2,1-3H3;3H/q+1;/p-1