84339-00-4 Usage
General Description
5H-Thiazolo(3,2-a)quinoline-4-carboxylic acid, 7-fluoro-8-(4-methyl-1-piperazinyl)-5-oxo- is a chemical compound with a complex and specific structure. It contains a thiazole ring fused to a quinoline ring, along with a carboxylic acid group and a fluoro substituent at position 7 of the quinoline ring. Additionally, it includes a piperazine ring with a methyl group at position 4, and a keto group at position 5 of the quinoline ring. 5H-Thiazolo(3,2-a)quinoline-4-carboxylic acid, 7-fluoro-8-(4-methyl-1- piperazinyl)-5-oxo- may have potential pharmaceutical applications due to its unique structure and biological activity, but further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 84339-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,3,3 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84339-00:
(7*8)+(6*4)+(5*3)+(4*3)+(3*9)+(2*0)+(1*0)=134
134 % 10 = 4
So 84339-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16FN3O3S/c1-19-2-4-20(5-3-19)13-9-12-10(8-11(13)18)15(22)14(17(23)24)16-21(12)6-7-25-16/h6-9H,2-5H2,1H3,(H,23,24)