844891-06-1 Usage
General Description
3-(2-methyl-1,3-thiazol-4-yl)benzonitrile is a chemical compound with the molecular formula C11H8N2S. It is a benzene derivative with a nitrile group and a thiazole ring, and it is commonly used as a building block in the synthesis of pharmaceutical compounds and agrochemicals. 3-(2-METHYL-1,3-THIAZOL-4-YL)BENZONITRILE is known for its potential biological activities, such as antibacterial and antifungal properties, and has been studied for its potential applications in drug development. Its unique structure and properties make it a valuable ingredient in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 844891-06-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,4,8,9 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 844891-06:
(8*8)+(7*4)+(6*4)+(5*8)+(4*9)+(3*1)+(2*0)+(1*6)=201
201 % 10 = 1
So 844891-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2S/c1-8-13-11(7-14-8)10-4-2-3-9(5-10)6-12/h2-5,7H,1H3
