84963-32-6 Usage
Description
7-isopropyl-5-methylbicyclo[2.2.2]octane-2-carbonitrile is a bicyclic chemical compound characterized by a complex molecular structure. It features a carbonitrile functional group and has isopropyl and methyl substituents at specific positions on the molecule. 7-isopropyl-5-methylbicyclo[2.2.2]octane-2-carbonitrile is of interest in the field of organic chemistry and may have potential applications in the development of pharmaceuticals or agrochemicals due to its unique structural features.
Uses
Used in Pharmaceutical Development:
7-isopropyl-5-methylbicyclo[2.2.2]octane-2-carbonitrile is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structural features make it a promising candidate for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Development:
7-isopropyl-5-methylbicyclo[2.2.2]octane-2-carbonitrile is used as a building block in the creation of agrochemicals, such as pesticides and herbicides. Its complex molecular structure allows for the design of novel compounds with improved efficacy and selectivity in agricultural applications.
Note: The specific applications and reasons for using 7-isopropyl-5-methylbicyclo[2.2.2]octane-2-carbonitrile in different industries would need to be further investigated through laboratory experiments and testing to determine its precise properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 84963-32-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,9,6 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84963-32:
(7*8)+(6*4)+(5*9)+(4*6)+(3*3)+(2*3)+(1*2)=166
166 % 10 = 6
So 84963-32-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H21N/c1-8(2)12-6-10-5-11(7-14)13(12)4-9(10)3/h8-13H,4-6H2,1-3H3
