850567-29-2 Usage
General Description
(3-Allylamino carbonyl)benzeneboronic acid is a chemical compound that is used in organic synthesis and medicinal chemistry. It is a boronic acid derivative that contains an allylamine functional group, which makes it a valuable building block for the synthesis of various pharmaceuticals and biologically active compounds. (3-ALLYLAMINOCARBONYL)BENZENEBORONIC ACID is commonly used as a reagent in Suzuki-Miyaura coupling reactions, which are widely used in the synthesis of complex organic molecules. Additionally, (3-Allylamino carbonyl)benzeneboronic acid has been explored for its potential as a therapeutic agent in the treatment of various diseases, including cancer and diabetes, due to its ability to interact with specific biological targets and modulate their activity.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-29-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 850567-29:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*2)+(1*9)=182
182 % 10 = 2
So 850567-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BNO3/c1-2-6-12-10(13)8-4-3-5-9(7-8)11(14)15/h2-5,7,14-15H,1,6H2,(H,12,13)
