850568-01-3 Usage
Description
(2-BROMOMETHYL-4-FLUOROBENZENE)BORONIC ACID, also known as 2-Bromomethyl-4-fluorophenylboronic Acid, is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It possesses a unique structure with a boronic acid group attached to a substituted benzene ring, which allows for versatile reactivity and functionalization in chemical reactions.
Uses
Used in Pharmaceutical Industry:
(2-BROMOMETHYL-4-FLUOROBENZENE)BORONIC ACID is used as a reactant for the preparation of Tavaborole, a topical antifungal medication. It plays a crucial role in the synthesis process, enabling the development of effective treatments for fungal infections affecting the skin and nails. (2-BROMOMETHYL-4-FLUOROBENZENE)BORONIC ACID's reactivity and functional groups contribute to the formation of the active pharmaceutical ingredient, making it an essential component in the production of Tavaborole.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-01-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850568-01:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*0)+(1*1)=173
173 % 10 = 3
So 850568-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BBrFO2/c9-4-5-3-6(10)1-2-7(5)8(11)12/h1-3,11-12H,4H2
