850568-17-1 Usage
Description
4-(O-METHYLHYDROXYLAMINOCARBONYL)PHENYLBORONIC ACID is an organic boronic acid compound characterized by the presence of a phenyl ring with a boronic acid group attached to the 4-position. It features a methoxyaminocarbonyl functional group, which contributes to its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
4-(O-METHYLHYDROXYLAMINOCARBONYL)PHENYLBORONIC ACID is used as a key intermediate in the synthesis of alkylsulfanyl-1,2,4-triazoles. These triazoles represent a new class of potent, allosteric valosine containing protein (VCP) inhibitors, which have potential therapeutic applications in the treatment of various diseases, including neurodegenerative disorders and cancer.
In the synthesis process, 4-(O-METHYLHYDROXYLAMINOCARBONYL)PHENYLBORONIC ACID serves as a crucial building block, enabling the formation of the desired triazole structures with the desired biological activity. Its unique chemical properties, such as the boronic acid group and the methoxyaminocarbonyl moiety, play a significant role in the formation of the final product and its subsequent biological effects.
Overall, 4-(O-METHYLHYDROXYLAMINOCARBONYL)PHENYLBORONIC ACID is a valuable compound in the pharmaceutical industry, particularly for the development of novel VCP inhibitors with potential therapeutic benefits. Its unique structure and reactivity make it an essential component in the synthesis of alkylsulfanyl-1,2,4-triazoles, which are promising candidates for the treatment of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-17-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 850568-17:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*1)+(1*7)=181
181 % 10 = 1
So 850568-17-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BNO4/c1-14-10-8(11)6-2-4-7(5-3-6)9(12)13/h2-5,12-13H,1H3,(H,10,11)
