850568-20-6 Usage
General Description
(4-allylaminocarbonyl)benzeneboronic acid is a chemical compound that consists of a benzene ring with a boronic acid group and an allylamine group attached to it. It is commonly used as a reagent in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. (4-ALLYLAMINOCARBONYL)BENZENEBORONIC ACID is a valuable tool in the field of medicinal chemistry and pharmaceutical research, as it can be used to create a wide range of biologically active molecules. Additionally, (4-allylaminocarbonyl)benzeneboronic acid has demonstrated potential as an anti-cancer agent and has been explored as a potential treatment for certain types of cancer. Its versatility and potential therapeutic applications make it an important compound in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-20-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 850568-20:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*2)+(1*0)=176
176 % 10 = 6
So 850568-20-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H16BNO5/c1-2-19-11(15)7-8-14-12(16)9-3-5-10(6-4-9)13(17)18/h3-6,17-18H,2,7-8H2,1H3,(H,14,16)
