850568-68-2 Usage
General Description
2-(4-Boronobenzene)-5,6-dihydro-4H-1,3-oxazine is a chemical compound with a unique structure that combines a boron-substituted benzene ring with a 1,3-oxazine ring. 2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE is of interest due to its potential applications in the field of organic chemistry, particularly in the synthesis of novel materials and pharmaceuticals. The boron atom in the benzene ring adds a unique and potentially useful property to the compound, making it a subject of interest for further investigation and potential exploitation in various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-68-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 850568-68:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*6)+(1*8)=192
192 % 10 = 2
So 850568-68-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BNO3/c13-11(14)9-4-2-8(3-5-9)10-12-6-1-7-15-10/h2-5,13-14H,1,6-7H2