85117-72-2 Usage
General Description
2-amino-N-(2-bromoethyl)benzamide is a chemical compound with the molecular formula C9H10BrN2O and a molecular weight of 240.09 g/mol. It is an organic compound that contains an amino group, a benzamide group, and a bromoethyl group. 2-amino-N-(2-bromoethyl)benzamide is commonly used in the pharmaceutical industry as an intermediate for the synthesis of various organic compounds. Its properties and uses make it a valuable building block for the development of pharmaceuticals and other products. Additionally, it may have potential applications in research and development in the fields of medicine and chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 85117-72-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,1 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 85117-72:
(7*8)+(6*5)+(5*1)+(4*1)+(3*7)+(2*7)+(1*2)=132
132 % 10 = 2
So 85117-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BrN2O/c10-5-6-12-9(13)7-3-1-2-4-8(7)11/h1-4H,5-6,11H2,(H,12,13)
