851628-34-7 Usage
General Description
4-(3-p-Tolyl-[1,2,4]oxadiazol-5-yl)-butyric acid is a chemical compound with a molecular structure that consists of a butyric acid core with a 1,2,4-oxadiazole ring system and a p-tolyl substitution. 4-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-BUTYRIC ACID is primarily used in research and development in the pharmaceutical industry, particularly for its potential therapeutic applications. The 1,2,4-oxadiazole ring system is known for its diverse pharmacological activities, including antimicrobial, antiviral, and anticancer properties. Additionally, the p-tolyl substitution may enhance the compound's targeting and binding affinity to specific biological receptors, making it a valuable tool for drug discovery and chemical biology studies. Overall, 4-(3-p-Tolyl-[1,2,4]oxadiazol-5-yl)-butyric acid has the potential to be a key component in the development of novel pharmaceuticals with improved therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 851628-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,6,2 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 851628-34:
(8*8)+(7*5)+(6*1)+(5*6)+(4*2)+(3*8)+(2*3)+(1*4)=177
177 % 10 = 7
So 851628-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O3/c1-9-5-7-10(8-6-9)13-14-11(18-15-13)3-2-4-12(16)17/h5-8H,2-4H2,1H3,(H,16,17)
