85168-87-2 Usage
Description
1-(2,2-dimethoxyethoxy)butane, also known as DMEB, is a chemical compound characterized by its molecular formula C10H22O4. It is a butane derivative featuring four carbon atoms, two oxygen atoms, and six hydrogen atoms. DMEB is recognized for its role as a solvent in various industrial applications, including pharmaceutical production and as a stabilizer in chemical reactions. Additionally, it is utilized in the formulation of fuel additives, as well as in the manufacturing processes of plastics and coatings. This colorless liquid exhibits a mild, sweet odor and is known to be flammable when exposed to heat or flame. Due to its moderate toxicity, DMEB should be handled with care, adhering to proper safety measures and protocols.
Uses
Used in Pharmaceutical Production:
1-(2,2-dimethoxyethoxy)butane is used as a solvent for facilitating various chemical reactions in the pharmaceutical industry. Its application is crucial for the synthesis of different drugs, enhancing the efficiency and effectiveness of the production process.
Used in Chemical Reactions:
DMEB is utilized as a stabilizer in chemical reactions to prevent unwanted side reactions and ensure the desired product is obtained. Its stabilizing properties contribute to the overall safety and reliability of the chemical processes.
Used in Fuel Additives:
1-(2,2-dimethoxyethoxy)butane is employed as a component in some fuel additives, where it aids in improving the performance and efficiency of the fuel, potentially leading to better engine performance and reduced emissions.
Used in Plastics Manufacturing:
DMEB is used as a component in the manufacturing of plastics, where it contributes to the desired properties of the final plastic product, such as flexibility, durability, and resistance to various environmental factors.
Used in Coatings Production:
In the coatings industry, 1-(2,2-dimethoxyethoxy)butane is used to enhance the properties of the coatings, such as adhesion, durability, and resistance to wear and tear. Its inclusion in the formulation can lead to improved performance and longevity of the coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 85168-87-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,6 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 85168-87:
(7*8)+(6*5)+(5*1)+(4*6)+(3*8)+(2*8)+(1*7)=162
162 % 10 = 2
So 85168-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H18O3/c1-4-5-6-11-7-8(9-2)10-3/h8H,4-7H2,1-3H3
85168-87-2Relevant articles and documents
IMPROVEMENTS IN OR RELATING TO ORGANIC COMPOUNDS
-
Paragraph 0093; 0094, (2016/11/24)
A process for the hydrogenation of a substrate comprising a carbon heteroatom double bond in the presence of a transition metal complex comprising a tridentate or bisdentate-ligand containing a nitrogen, sulphur and phosphorus atom, of which at least the N- and P- and optionally also the S-atom coordinates with the transition metal.
