85476-90-0 Usage
Structure
The compound is a derivative of 1-naphthaleneacetic acid, which is characterized by a naphthalene ring and an acetic acid side chain. The molecule has a complex structure with various functional groups, including a 2-oxo-2-(1-piperidinyl)ethyl group, a 1-piperazinyl group, and an ethoxycarbonyl group attached to a phenyl ring.
Plant growth regulation
As a derivative of naphthaleneacetic acid, this compound is likely to have plant growth regulatory properties. This makes it potentially useful in horticulture and agriculture for promoting or inhibiting plant growth, depending on the desired application.
Pharmaceutical potential
The presence of a piperazine moiety in the structure suggests that this compound may have potential pharmaceutical applications. It could be used as a prodrug, which is a biologically inactive compound that is metabolized in the body to release an active pharmaceutical ingredient.
Water solubility
Being a dihydrochloride salt indicates that this compound is a water-soluble form. This property may enhance its bioavailability for certain applications, as it can dissolve in aqueous environments and be more easily absorbed by biological systems.
Good bioavailability
The water solubility of the dihydrochloride salt form may contribute to good bioavailability, which is essential for the compound's effectiveness in various applications, such as plant growth regulation or pharmaceutical use.
Further research needed
Despite the potential properties and applications mentioned above, further research is required to determine the specific properties, applications, and potential risks associated with this compound. This includes understanding its mechanism of action, toxicity, and long-term effects on plants, animals, and humans.
Check Digit Verification of cas no
The CAS Registry Mumber 85476-90-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,4,7 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85476-90:
(7*8)+(6*5)+(5*4)+(4*7)+(3*6)+(2*9)+(1*0)=170
170 % 10 = 0
So 85476-90-0 is a valid CAS Registry Number.
InChI:InChI=1/C32H37N3O5.2ClH/c36-30(35-15-4-1-5-16-35)24-34-19-17-33(18-20-34)21-22-39-32(38)26-11-13-28(14-12-26)40-31(37)23-27-9-6-8-25-7-2-3-10-29(25)27;;/h2-3,6-14H,1,4-5,15-24H2;2*1H
85476-90-0Relevant articles and documents
Piperazine derivatives, of aromatic acids
-
, (2008/06/13)
A piperazine derivartive represented by the following formula: STR1 wherein R1 : an indolyl group which may optionally be substituted by one or more lower alkyl and/or lower alkoxy groups, naphthyl group which may optionally be saturated partia