85721-29-5 Usage
Description
4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene is a complex chemical compound featuring a 10-carbon decane ring with an allyl group at the fourth carbon and a methyl group at the 1a position. It also has a unique three-membered oxirane ring fused to a naphthalene backbone, creating a fused polycyclic structure. 4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene may serve as a building block for organic synthesis or as a precursor in the production of other chemical compounds, with its specific properties and potential applications requiring further investigation through chemical analysis and testing.
Uses
Used in Organic Synthesis:
4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene is used as a building block in organic synthesis for its complex molecular structure and potential to form new chemical compounds.
Used in Chemical Production:
4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene is used as a precursor in the production of other chemical compounds, given its unique fused polycyclic structure and the possibility of further chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 85721-29-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,2 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 85721-29:
(7*8)+(6*5)+(5*7)+(4*2)+(3*1)+(2*2)+(1*9)=145
145 % 10 = 5
So 85721-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O/c1-3-4-9-5-10-6-11(9)13-8-15(2)14(16-15)7-12(10)13/h3,9-14H,1,4-8H2,2H3