857758-88-4 Usage
General Description
3,6-Dibromo-4-hydroxyquinoline is a chemical compound with the molecular formula C9H6Br2NO, and a molar mass of 308.959 g/mol. It is a derivative of quinoline, a heterocyclic aromatic organic compound. This chemical is commonly used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It possesses antimicrobial properties and has been investigated for its potential use as an antifungal agent. Additionally, 3,6-Dibromo-4-hydroxyquinoline has been studied for its inhibitory effects on the growth of cancer cells and its potential use in cancer treatments. 3,6-DIBROMO-4-HYDROXYQUINOLINE is considered hazardous, and appropriate precautions should be taken when handling it.
Check Digit Verification of cas no
The CAS Registry Mumber 857758-88-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,7,5 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 857758-88:
(8*8)+(7*5)+(6*7)+(5*7)+(4*5)+(3*8)+(2*8)+(1*8)=244
244 % 10 = 4
So 857758-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H5Br2NO/c10-5-1-2-8-6(3-5)9(13)7(11)4-12-8/h1-4H,(H,12,13)
