85922-30-1 Usage
Description
(R)-(-)-N-[1-(1-NAPHTHYL)ETHYL]-3,5-DINITROBENZAMIDE is a chiral molecule that belongs to the class of dinitro-substituted benzamides. It features a specific stereochemistry and a nitro group on the benzene ring, which can impart unique properties and reactivity to the compound. This characteristic makes it valuable in organic synthesis and pharmaceutical research, where it can be utilized as a building block for the preparation of other organic compounds or serve as a ligand in asymmetric catalysis. The stereochemistry of the compound plays a crucial role in determining its biological activity and behavior in various systems.
Uses
Used in Organic Synthesis:
(R)-(-)-N-[1-(1-NAPHTHYL)ETHYL]-3,5-DINITROBENZAMIDE is used as a building block in organic synthesis for the creation of other organic compounds. Its unique structure and reactivity, due to the presence of the dinitro and naphthyl groups, make it a valuable component in the synthesis of various molecules with specific properties and functions.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (R)-(-)-N-[1-(1-NAPHTHYL)ETHYL]-3,5-DINITROBENZAMIDE is used as a ligand in asymmetric catalysis. Its stereochemistry is essential in determining the biological activity and behavior of the resulting compounds, which can be crucial for the development of new drugs with improved efficacy and selectivity.
Used in Chemical Processes:
(R)-(-)-N-[1-(1-NAPHTHYL)ETHYL]-3,5-DINITROBENZAMIDE is also utilized in various chemical processes due to its specific properties and reactivity. The presence of the dinitro and naphthyl groups allows it to participate in a range of reactions, making it a versatile molecule for use in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 85922-30-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,9,2 and 2 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85922-30:
(7*8)+(6*5)+(5*9)+(4*2)+(3*2)+(2*3)+(1*0)=151
151 % 10 = 1
So 85922-30-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H15N3O5/c1-12(17-8-4-6-13-5-2-3-7-18(13)17)20-19(23)14-9-15(21(24)25)11-16(10-14)22(26)27/h2-12H,1H3,(H,20,23)/t12-/m1/s1
85922-30-1Relevant articles and documents
A Versatile and practical solvating agent for enantioselective recognition and NMR analysis of protected amines
Iwaniuk, Daniel P.,Wolf, Christian
supporting information; experimental part, p. 6724 - 6727 (2010/12/19)
The 3,5-dinitrobenzoyl-derived 1-naphthylethyl amide 3 is an attractive CSA for NMR analysis of protected amines. It is readily prepared in a single step and combines practical resolution of diastereomeric complexes due to signal sharpness and effective signal separation. Crystallographic analysis shows that 3 forms a chiral cleft that can selectively bind one enantiomer of a substrate through hydrogen bonding, π-π stacking, and CH/π interactions. The enantioselective complex formation causes strong upfield shifts in the 1H NMR spectrum even in the presence of only 5 mol % of 3.
Chiral NMR shift reagents: Mixtures of lanthanide tris (β-diketonates) with chiral carboxylate anions
Wenzel, Thomas J.,Bean, Amy C.,Dunham, Sarah L.
, p. 395 - 402 (2007/10/03)
Chiral carboxylic acids such as N-(R)-1-(1-naphthyl)ethylaminocarbonyl-L-tert-leucine, N-(R)-1-(1-naphthyl)ethylaminocarbonyl-L-valine and N-(3,5-dinitrobenzoyl)-L-leucine are solubilized in chloroform by the addition of triethylamine. The resulting ion p