86-15-7 Usage
Description
4-(2,5-dibutoxy-4-nitrophenyl)morpholine is a morpholine derivative featuring a nitrophenyl substitution with two butoxy groups attached to the phenyl ring. This chemical compound has garnered interest for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis.
Uses
Used in Pharmaceutical Industry:
4-(2,5-dibutoxy-4-nitrophenyl)morpholine is used as a potential intermediate in the synthesis of pharmaceutical compounds due to its unique structural features, which may contribute to the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(2,5-dibutoxy-4-nitrophenyl)morpholine is utilized as a potential intermediate for the production of agrochemicals, potentially leading to the creation of novel pesticides or other agricultural chemicals that can improve crop protection and yield.
Used in Organic Synthesis:
4-(2,5-dibutoxy-4-nitrophenyl)morpholine serves as a building block in organic synthesis, allowing chemists to construct more complex molecules with diverse applications across various industries.
Used in Chemical Research and Development:
As a subject of interest for further research, 4-(2,5-dibutoxy-4-nitrophenyl)morpholine may exhibit biological or pharmacological activities, making it a valuable compound for exploring new avenues in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 86-15-7 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 86-15:
(4*8)+(3*6)+(2*1)+(1*5)=57
57 % 10 = 7
So 86-15-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H28N2O5/c1-3-5-9-24-17-14-16(20(21)22)18(25-10-6-4-2)13-15(17)19-7-11-23-12-8-19/h13-14H,3-12H2,1-2H3