86061-00-9 Usage
Description
FMOC-GLN-OPFP, with the chemical name 9-fluorenylmethoxycarbonyl-L-glutamine (4-(trifluoromethyl)phenyl) ester, is a glutamine derivative that serves as a valuable building block in the field of organic chemistry and peptide synthesis. It is characterized by its unique structure, which includes a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group and a 4-(trifluoromethyl)phenyl ester moiety, making it a versatile compound for various applications.
Uses
Used in Pharmaceutical Industry:
FMOC-GLN-OPFP is used as a building block for the synthesis of anti-HIV-1 peptide derivatives. Its incorporation into peptide structures allows for the development of therapeutic agents that can target and combat the Human Immunodeficiency Virus Type 1 (HIV-1), contributing to the advancement of treatments for HIV/AIDS.
Used in Organic Chemistry:
As a glutamine derivative, FMOC-GLN-OPFP is utilized in the synthesis of various organic compounds and molecules. Its unique structure, featuring the Fmoc protecting group and the 4-(trifluoromethyl)phenyl ester, makes it a suitable candidate for the creation of complex organic molecules with potential applications in various fields, such as pharmaceuticals, materials science, and agrochemicals.
Used in Peptide Synthesis:
FMOC-GLN-OPFP plays a crucial role in peptide synthesis, where it serves as a protected amino acid building block. The Fmoc group provides a stable and easily removable protecting group for the amino side chain, facilitating the stepwise assembly of peptide sequences. This allows for the efficient and controlled synthesis of peptides with specific functions and properties, such as those with anti-HIV-1 activity or other therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 86061-00-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,0,6 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 86061-00:
(7*8)+(6*6)+(5*0)+(4*6)+(3*1)+(2*0)+(1*0)=119
119 % 10 = 9
So 86061-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H19F5N2O5/c27-19-20(28)22(30)24(23(31)21(19)29)38-25(35)17(9-10-18(32)34)33-26(36)37-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H2,32,34)(H,33,36)/t17-/m0/s1