86718-18-5 Usage
Description
4-AMINO-2-ETHOXY-5-NITRO-BENZOIC ACID is an organic compound characterized by the presence of an amino group, an ethoxy group, and a nitro group attached to a benzene ring with a carboxylic acid functional group. This chemical structure endows it with unique properties that make it suitable for various applications, particularly in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
4-AMINO-2-ETHOXY-5-NITRO-BENZOIC ACID is used as a reactant for the preparation of Cinitapride (C441990), a medication primarily used to treat gastrointestinal disorders. Its unique chemical structure allows it to interact with specific receptors in the body, helping to regulate muscle contractions and alleviate symptoms associated with gastrointestinal motility issues.
Check Digit Verification of cas no
The CAS Registry Mumber 86718-18-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,7,1 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 86718-18:
(7*8)+(6*6)+(5*7)+(4*1)+(3*8)+(2*1)+(1*8)=165
165 % 10 = 5
So 86718-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O5/c1-2-16-8-4-6(10)7(11(14)15)3-5(8)9(12)13/h3-4H,2,10H2,1H3,(H,12,13)
86718-18-5Relevant articles and documents
Novel N-(3-hydroxy-4-piperidinyl)benzamide derivatives
-
, (2008/06/13)
Novel N-(3-hydroxy-4-piperidinyl)benzamides and derivatives thereof, said compounds being useful as stimulators of the motility of the gastro-intestinal system.
