868948-12-3 Usage
Description
Butanamide, N-(6-chloro-3-pyridazinyl)-, also known as 6-chloro-3-(pyridazin-3-yl)butanamide, is a chemical compound with the molecular formula C9H10ClN3O. It is a derivative of pyridazine and is classified as an amide. This organic compound is characterized by a pyridazine ring with a chloro substituent at the 6th position and an amide group, making it a versatile compound for medicinal chemistry research and drug development. Its potential applications in the field of medicine make it an important compound for further study and analysis.
Uses
Used in Pharmaceutical Industry:
Butanamide, N-(6-chloro-3-pyridazinyl)is used as an intermediate in the synthesis of pharmaceutical drugs for its potential therapeutic effects. Its unique chemical structure allows it to be a promising candidate for the development of new drugs with various medicinal properties.
Used in Medicinal Chemistry Research:
Butanamide, N-(6-chloro-3-pyridazinyl)is used as a research compound in medicinal chemistry to explore its potential as a therapeutic agent. Its chemical structure provides a foundation for further modification and optimization to enhance its pharmacological properties and improve its efficacy in treating various diseases.
Used in Drug Development:
Butanamide, N-(6-chloro-3-pyridazinyl)is used in drug development to create new pharmaceutical drugs with potential therapeutic effects. Its unique structure and properties make it a valuable compound for the design and synthesis of novel drugs targeting specific medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 868948-12-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,9,4 and 8 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 868948-12:
(8*8)+(7*6)+(6*8)+(5*9)+(4*4)+(3*8)+(2*1)+(1*2)=243
243 % 10 = 3
So 868948-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN3O/c1-2-3-8(13)10-7-5-4-6(9)11-12-7/h4-5H,2-3H2,1H3,(H,10,12,13)
