869901-15-5 Usage
Description
1-METHYL-5-THIEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID is a chemical compound with potential therapeutic applications, belonging to the class of pyrazole carboxylic acids. It features a methyl group and a thienyl ring in its molecular structure, which contribute to its promising bioactivity in preclinical studies. 1-METHYL-5-THIEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID has been extensively investigated for its potential as an anti-inflammatory and anti-cancer agent, and it may also have applications in treating various other diseases. Ongoing research aims to fully understand its pharmacological properties and potential uses in the field of medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
1-METHYL-5-THIEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID is used as a potential therapeutic agent for its anti-inflammatory and anti-cancer properties. Its unique molecular structure allows it to target specific biological pathways and modulate immune responses, making it a promising candidate for the development of new drugs to treat various diseases.
Used in Medicinal Chemistry Research:
1-METHYL-5-THIEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID is used as a key compound in medicinal chemistry research to explore its potential applications in drug development. Its unique structure and bioactivity provide valuable insights into the design and synthesis of new therapeutic agents with improved efficacy and safety profiles.
Used in Drug Development:
1-METHYL-5-THIEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID is used in drug development as a lead compound for the discovery of novel therapeutic agents. Its potential as an anti-inflammatory and anti-cancer agent, along with its ability to target specific biological pathways, makes it an attractive candidate for further optimization and development into effective drugs for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 869901-15-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,9,9,0 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 869901-15:
(8*8)+(7*6)+(6*9)+(5*9)+(4*0)+(3*1)+(2*1)+(1*5)=215
215 % 10 = 5
So 869901-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2S/c1-11-7(8-3-2-4-14-8)5-6(10-11)9(12)13/h2-5H,1H3,(H,12,13)
