869901-23-5 Usage
Description
1-(6-METHYLPYRAZIN-2-YL)-1,4-DIAZEPANE is a heterocyclic chemical compound with the molecular formula C11H18N4. It features a six-membered and a seven-membered ring, with a methylpyrazinyl group attached to the nitrogen atom in the smaller ring. 1-(6-METHYLPYRAZIN-2-YL)-1,4-DIAZEPANE may have potential applications in pharmaceutical research or as a building block in organic synthesis, depending on its chemical reactivity, stability, and unique characteristics.
Uses
Used in Pharmaceutical Research:
1-(6-METHYLPYRAZIN-2-YL)-1,4-DIAZEPANE is used as a research compound for exploring its potential pharmaceutical applications. Its unique structure and properties may contribute to the development of new drugs or therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(6-METHYLPYRAZIN-2-YL)-1,4-DIAZEPANE serves as a building block or intermediate in the synthesis of more complex organic molecules. Its reactivity and stability make it a valuable component in creating a variety of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 869901-23-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,9,9,0 and 1 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 869901-23:
(8*8)+(7*6)+(6*9)+(5*9)+(4*0)+(3*1)+(2*2)+(1*3)=215
215 % 10 = 5
So 869901-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N4/c1-9-7-12-8-10(13-9)14-5-2-3-11-4-6-14/h7-8,11H,2-6H2,1H3
