87-74-1 Usage
Description
D-glycero-D-gulo-heptonic acid is a carbohydrate acid that is heptanoic acid substituted by hydroxy groups at C-2, C-3, C-4, C-5, C-6, and C-7.
Uses
Used in Pharmaceutical Industry:
D-glycero-D-gulo-heptonic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds, particularly for the production of L-ascorbic acid (vitamin C). Its unique structure allows for the efficient synthesis of this essential vitamin, which plays a crucial role in human health and metabolism.
Used in Food Industry:
D-glycero-D-gulo-heptonic acid is used as a flavor enhancer and a building block for the synthesis of other flavor compounds in the food industry. Its ability to form various derivatives and complexes with other molecules makes it a valuable ingredient in creating unique and desirable flavors in food products.
Used in Cosmetic Industry:
D-glycero-D-gulo-heptonic acid is used as a humectant and skin conditioning agent in cosmetic formulations. Its hygroscopic properties help to retain moisture in the skin, promoting hydration and maintaining skin health. Additionally, it can be used as a starting material for the synthesis of other cosmetic ingredients, such as antioxidants and skin brightening agents.
Check Digit Verification of cas no
The CAS Registry Mumber 87-74-1 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 87-74:
(4*8)+(3*7)+(2*7)+(1*4)=71
71 % 10 = 1
So 87-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4+,5-,6-/m1/s1
