870062-76-3 Usage
General Description
2-Chloro-3-fluoro-5-hydroxypyridine is a chemical compound with the molecular formula C5H3ClFNO. It is a pyridine derivative that contains chlorine, fluorine, and a hydroxyl group attached to the pyridine ring. 2-Chloro-3-fluoro-5-hydroxypyridine has several potential applications in the pharmaceutical and agricultural industries, as it can be used as a building block in the synthesis of various pharmaceutical drugs and agrochemicals. Its unique structure and properties make it a useful intermediate in organic synthesis, allowing for the production of a wide range of functionalized pyridine derivatives. Additionally, it has potential as a key ingredient in the development of new drugs and crop protection products.
Check Digit Verification of cas no
The CAS Registry Mumber 870062-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,0,6 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 870062-76:
(8*8)+(7*7)+(6*0)+(5*0)+(4*6)+(3*2)+(2*7)+(1*6)=163
163 % 10 = 3
So 870062-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClFNO/c6-5-4(7)1-3(9)2-8-5/h1-2,9H