870065-73-9 Usage
Description
2,5,6-Trifluoronicotinic acid nitrile is a pyridine derivative characterized by the presence of three fluorine atoms at the 2nd, 5th, and 6th positions on the pyridine ring. This unique structure endows it with specific chemical properties and reactivity, making it a valuable compound in various applications.
Uses
Used in Pharmaceutical Industry:
2,5,6-Trifluoronicotinic acid nitrile is used as a key intermediate in the synthesis of JAK2 kinase inhibitors for the treatment of various diseases, including cancer and inflammatory disorders. Its unique structure allows for the development of targeted therapies that can modulate the activity of JAK2 kinase, a crucial enzyme involved in cell signaling pathways.
Used in Chemical Synthesis:
2,5,6-Trifluoronicotinic acid nitrile is also utilized as a versatile building block in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactivity and the presence of fluorine atoms make it an attractive candidate for the development of novel molecules with improved properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 870065-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,0,6 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 870065-73:
(8*8)+(7*7)+(6*0)+(5*0)+(4*6)+(3*5)+(2*7)+(1*3)=169
169 % 10 = 9
So 870065-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C6HF3N2/c7-4-1-3(2-10)5(8)11-6(4)9/h1H
870065-73-9Relevant articles and documents
Fluorinated pyridine N-oxide thrombin modulators and process for N-oxidation of nitrogen containing heteroaryls
-
Page/Page column 12, (2008/06/13)
The present invention describes compounds of Formula I or a pharmaceutically acceptable salt thereof, for the prophylaxis, or treatment of diseases and conditions related to thrombin activity in a mammal. The present invention also relates to a novel method of N-oxidation of nitrogen containing heteroaryls.
