872355-64-1 Usage
Description
1H-PYRROLO[3,2-B]PYRIDINE-5-CARBOXYLIC ACID is an organic compound that serves as a key reactant in the synthesis of various pharmaceutical compounds. It is characterized by its unique heterocyclic structure, which consists of a pyrrolo fused with a pyridine ring, and a carboxylic acid group attached to the 5th position. This structure endows it with versatile chemical properties, making it a valuable building block in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
1H-PYRROLO[3,2-B]PYRIDINE-5-CARBOXYLIC ACID is used as a reactant for the preparation process of piperazinones. These piperazinones are specifically designed as inhibitors of arenavirus replication, which are important for the development of antiviral drugs targeting arenaviruses, a family of viruses that can cause severe hemorrhagic fevers in humans.
In the synthesis of piperazinones, 1H-PYRROLO[3,2-B]PYRIDINE-5-CARBOXYLIC ACID plays a crucial role by providing the necessary structural framework for the formation of the final product. The resulting piperazinones can then be further optimized and studied for their antiviral properties, potentially leading to the discovery of new therapeutic agents against arenavirus infections.
Check Digit Verification of cas no
The CAS Registry Mumber 872355-64-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,2,3,5 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 872355-64:
(8*8)+(7*7)+(6*2)+(5*3)+(4*5)+(3*5)+(2*6)+(1*4)=191
191 % 10 = 1
So 872355-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2/c11-8(12)7-2-1-5-6(10-7)3-4-9-5/h1-4,9H,(H,11,12)
872355-64-1Relevant articles and documents
AZAINDOLE DERIVATIVES AS INHIBITORS OF P38 KINASE
-
, (2010/11/24)
The invention is directed to methods to inhibit p38 kinase, preferably p38-α using compounds which are azaindoles wherein the azaindoles are coupled through an azacyclic linker to another cyclic moiety.
