87395-55-9 Usage
Description
[1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate is a complex chemical compound derived from tropane alkaloids, featuring a bicyclic structure with a nitrogen atom and a pyrido[3,2-b][1,4]benzothiazine-10-carboxylate moiety. [1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate is optically active, characterized by its specific stereochemistry denoted by the [1R,5S,(+)] prefix, and contains a nitrogen and sulfur atom within the benzothiazine ring. Its intricate structure suggests potential pharmacological properties, making it a promising candidate for the development of novel drugs.
Uses
Used in Pharmaceutical Industry:
[1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate is used as a starting compound for the development of new drugs due to its complex structure and potential pharmacological properties. Its unique stereochemistry and the presence of multiple bioactive moieties make it an interesting candidate for further research and drug design.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, [1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate serves as a valuable compound for studying its interactions with various biological targets. Its structural features may provide insights into the design of more effective and selective drugs, particularly for targeting complex diseases.
Used in Drug Synthesis:
[1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structural elements can be exploited to create novel drug candidates with improved efficacy, selectivity, and reduced side effects.
Used in Drug Delivery Systems:
Similar to other complex chemical compounds, [1R,5S,(+)]-Tropane-2α-yl=10H-pyrido[3,2-b][1,4]benzothiazine-10-carboxylate can be utilized in the development of advanced drug delivery systems. These systems aim to improve the bioavailability, targeting, and overall therapeutic outcomes of the compound by employing various carriers, such as organic and metallic nanoparticles.
Check Digit Verification of cas no
The CAS Registry Mumber 87395-55-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,3,9 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 87395-55:
(7*8)+(6*7)+(5*3)+(4*9)+(3*5)+(2*5)+(1*5)=179
179 % 10 = 9
So 87395-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N3O2S/c1-22-13-8-10-14(22)16(11-9-13)25-20(24)23-15-5-2-3-6-17(15)26-18-7-4-12-21-19(18)23/h2-7,12-14,16H,8-11H2,1H3/t13?,14-,16?/m1/s1
87395-55-9Relevant articles and documents
Parasympatholytic (Anticholinergic) Esters of the Isomeric 2-Tropanols. 2. Non-Glycolates
Atkinson, Edward R.,McRitchie-Ticknor, Donna D.,Harris, Louis S.,Archer, Sydney,Aceto, Mario D.,et al.
, p. 1772 - 1775 (2007/10/02)
The 19 esters in Table I were prepared from (+)-2α-tropanol, (-)-2β-tropanol, (+/-)-3-quinuclidinol, and a variety of non-glycolic acids in order to compare their central and pheripheral activities with those of the glycolates reported in the previous paper.The results (Table II) showed that esters 6 and 17 were approximately equivalent to one another and the atropine, that 8 was equal in both central and peripheral activity to reference glycolates, that 9 and 19 were less active than 8 but 9 had a substantially reduced central activity, and that 10 and 11 weremore active than the methoxy analogue reported earlier.