876-07-3 Usage
Description
4-Bromomethyl benzoyl bromide, also known as para-substituted benzoyl bromide, is an organic compound characterized by the presence of a bromomethyl group (-CH2Br) attached to a benzoyl bromide moiety. This chemical structure endows it with unique reactivity and properties, making it a versatile intermediate in organic synthesis.
Uses
Used in Pharmaceutical Industry:
4-Bromomethyl benzoyl bromide is used as a key intermediate in the synthesis of various pharmaceutical compounds. It is particularly employed in the preparation of 4-(bromomethyl)-N-[(S)-3-ethyl-3-hydroxy-1-phenylpentan-2-yl]benzamide, a compound with potential therapeutic applications.
Used in Polymer Industry:
In the polymer industry, 4-bromomethyl benzoyl bromide is utilized as a reactive monomer for the synthesis of α-methoxy-ω-4-(bromomethyl) benzoic acid ester-poly(ethylene glycol) 2000. This polymer is known for its unique properties, such as biocompatibility and hydrophilicity, which make it suitable for various applications, including drug delivery systems and surface coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 876-07-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 876-07:
(5*8)+(4*7)+(3*6)+(2*0)+(1*7)=93
93 % 10 = 3
So 876-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Br2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2