877-09-8 Usage
Description
2,4,5,6-Tetrachloro-m-xylene is an organic compound with the chemical formula C8H2Cl4. It is a colorless crystalline solid that is insoluble in water and has a molecular weight of approximately 215.00 g/mol. 2,4,5,6-Tetrachloro-m-xylene is characterized by the presence of four chlorine atoms attached to a xylene ring, which gives it unique chemical properties and makes it a versatile intermediate in various chemical reactions.
Uses
Used in Pesticide Synthesis:
2,4,5,6-Tetrachloro-m-xylene is used as an intermediate in the synthesis of various pesticides and their metabolites. Its chemical structure allows it to be easily modified and incorporated into the molecular structure of different pesticides, enhancing their effectiveness in controlling pests and protecting crops.
Used in Quinol Nitrate Preparation:
2,4,5,6-Tetrachloro-m-xylene is also utilized in the preparation of Quinol nitrates, which are a class of compounds with potential applications in various industries. The versatility of 2,4,5,6-tetrachloro-m-xylene enables it to be a key component in the synthesis of these compounds, contributing to their unique properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 877-09-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 877-09:
(5*8)+(4*7)+(3*7)+(2*0)+(1*9)=98
98 % 10 = 8
So 877-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Cl4/c1-3-5(9)4(2)7(11)8(12)6(3)10/h1-2H3