87751-73-3 Usage
Description
(2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid is an organic compound with a molecular formula C17H16O5. It features a phenyl group and an acrylic acid functional group, along with hydroxyphenyl and ethoxy functional groups attached to the phenyl group. This chemical may have potential applications in various fields, including pharmaceuticals, organic synthesis, and research, depending on its specific structure and characteristics.
Uses
Used in Pharmaceutical Industry:
(2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure with phenyl, acrylic acid, hydroxyphenyl, and ethoxy groups may contribute to its activity against certain diseases or conditions, making it a candidate for drug development.
Used in Organic Synthesis:
In the field of organic synthesis, (2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid serves as a key intermediate or building block for the synthesis of more complex organic molecules. Its functional groups can be utilized in various chemical reactions to form a wide range of compounds with diverse applications.
Used in Research:
(2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid is also used in research settings to study its chemical properties, reactivity, and potential interactions with other molecules. This can lead to a better understanding of its behavior and possible applications in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 87751-73-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,7,5 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 87751-73:
(7*8)+(6*7)+(5*7)+(4*5)+(3*1)+(2*7)+(1*3)=173
173 % 10 = 3
So 87751-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H16O4/c1-2-21-16-11-12(8-9-15(16)18)10-14(17(19)20)13-6-4-3-5-7-13/h3-11,18H,2H2,1H3,(H,19,20)/p-1/b14-10-
87751-73-3Relevant articles and documents
Antioxidant, anti-tyrosinase and anti-melanogenic effects of (E)-2,3-diphenylacrylic acid derivatives
Ullah, Sultan,Park, Yujin,Park, Chaeun,Lee, Sanggwon,Kang, Dongwan,Yang, Jungho,Akter, Jinia,Chun, Pusoon,Moon, Hyung Ryong
, p. 2192 - 2200 (2019/04/30)
During our continued search for strong skin whitening agents over the past ten years, we have investigated the efficacies of many tyrosinase inhibitors containing a common (E)-β-phenyl-α,β-unsaturated carbonyl scaffold, which we found to be essential for
