88307-68-0 Usage
Description
1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE is a chemical compound that belongs to the class of tetrahydroisoquinoline alkaloids. It is a derivative of the natural product isoquinoline and is commonly used in research and medical applications. 1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE has potential pharmaceutical properties and has been studied for its potential use in the treatment of various diseases, including Parkinson's disease and cancer. Its structure contains a hydroxyphenyl group and methoxy groups, which contribute to its biological activity and pharmacological effects. The hydrochloride salt form of this compound is often used for enhanced solubility and stability in various applications.
Uses
Used in Pharmaceutical Applications:
1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE is used as a pharmaceutical agent for its potential therapeutic effects on various diseases. 1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE's unique structure and properties make it a promising candidate for the development of new drugs and treatments.
Used in Research Applications:
In the field of research, 1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE is used as a research tool to study the mechanisms of action and potential applications in various diseases, particularly Parkinson's disease and cancer. Its unique structure allows researchers to investigate its interactions with biological targets and understand its pharmacological effects.
Used in Drug Development:
1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE is used as a lead compound in drug development for the treatment of various diseases. Its potential pharmaceutical properties and biological activity make it a valuable starting point for the design and synthesis of new drugs with improved efficacy and safety profiles.
Used in Chemical Synthesis:
In the chemical industry, 1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE can be used as a starting material or intermediate in the synthesis of other complex organic compounds, particularly those with potential pharmaceutical or biological applications.
Used in Analytical Chemistry:
1-(2-HYDROXYPHENYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE can be used as a reference compound or standard in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry (MS), for the detection and quantification of related compounds in biological samples or pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 88307-68-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,3,0 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 88307-68:
(7*8)+(6*8)+(5*3)+(4*0)+(3*7)+(2*6)+(1*8)=160
160 % 10 = 0
So 88307-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H19NO3.ClH/c1-20-15-9-11-7-8-18-17(13(11)10-16(15)21-2)12-5-3-4-6-14(12)19;/h3-6,9-10,17-19H,7-8H2,1-2H3;1H
