883541-03-5 Usage
General Description
2-AMINOPROPYL-5(6)-FLUORO-BENZIMIDAZOLE is a chemical compound that belongs to the benzimidazole class. It is a derivative of benzimidazole with a fluorine atom attached to the 5th or 6th carbon atom and a 2-aminopropyl group attached to the nitrogen atom. 2-AMINOPROPYL-5(6)-FLUORO-BENZIMIDAZOLE has potential applications in the field of medicinal chemistry, particularly as a building block for the synthesis of various pharmaceutical compounds. Its chemical structure and properties make it a valuable intermediate in the development of drugs targeting specific biological pathways, such as anti-cancer or anti-inflammatory agents. Additionally, 2-AMINOPROPYL-5(6)-FLUORO-BENZIMIDAZOLE may also have other industrial uses and applications in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 883541-03-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,3,5,4 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 883541-03:
(8*8)+(7*8)+(6*3)+(5*5)+(4*4)+(3*1)+(2*0)+(1*3)=185
185 % 10 = 5
So 883541-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H12FN3/c11-7-3-4-8-9(6-7)14-10(13-8)2-1-5-12/h3-4,6H,1-2,5,12H2,(H,13,14)
